C18H31GdN4O9 — CID 155802509
2-[4,10-bis(carboxylatomethyl)-7-[(2R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (PubChem CID 155802509) has the molecular formula C18H31GdN4O9 and a molecular weight of 604.72 g/mol. Its IUPAC name is 2-[4,10-bis(carboxylatomethyl)-7-[(2R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+).
| Compound Name | 2-[4,10-bis(carboxylatomethyl)-7-[(2R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 155802509 |
| Molecular Formula | C18H31GdN4O9 |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | 2-[4,10-bis(carboxylatomethyl)-7-[(2R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| SMILES | O=C([O-])CN1CCN(CC(=O)[O-])CCN([C@H](CO)C(O)CO)CCN(CC(=O)[O-])CC1.[Gd+3] |
| InChI | InChI=1S/C18H34N4O9.Gd/c23-12-14(15(25)13-24)22-7-5-20(10-17(28)29)3-1-19(9-16(26)27)2-4-21(6-8-22)11-18(30)31;/h14-15,23-25H,1-13H2,(H,26,27)(H,28,29)(H,30,31);/q;+3/p-3/t14-,15?;/m1./s1 |
| InChIKey | ZPDFIIGFYAHNSK-FUISWZMFSA-K |
| XLogP | -7.83 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | -7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |