C15H28N4O9 — CID 125116953
10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid (PubChem CID 125116953) has the molecular formula C15H28N4O9 and a molecular weight of 408.41 g/mol. Its IUPAC name is 10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid.
| Compound Name | 10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
|---|---|
| PubChem CID | 125116953 |
| Molecular Formula | C15H28N4O9 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)O)CCN([C@H](CO)[C@H](O)CO)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C15H28N4O9/c20-9-11(12(22)10-21)16-1-3-17(13(23)24)5-7-19(15(27)28)8-6-18(4-2-16)14(25)26/h11-12,20-22H,1-10H2,(H,23,24)(H,25,26)(H,27,28)/t11-,12-/m1/s1 |
| InChIKey | APKUUESNVQSQDY-VXGBXAGGSA-N |
| XLogP | -2.04 |
| TPSA | 185.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |