C16H30GdN4O9 — CID 53464987
gadolinium;2-methyl-10-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid (PubChem CID 53464987) has the molecular formula C16H30GdN4O9 and a molecular weight of 579.69 g/mol. Its IUPAC name is gadolinium;2-methyl-10-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid.
| Compound Name | gadolinium;2-methyl-10-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
|---|---|
| PubChem CID | 53464987 |
| Molecular Formula | C16H30GdN4O9 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | gadolinium;2-methyl-10-[(2R,3R)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
| SMILES | CC1CN(C(=O)O)CCN(C(=O)O)CCN([C@H](CO)[C@@H](O)CO)CCN1C(=O)O.[Gd] |
| InChI | InChI=1S/C16H30N4O9.Gd/c1-11-8-19(15(26)27)5-4-18(14(24)25)3-2-17(6-7-20(11)16(28)29)12(9-21)13(23)10-22;/h11-13,21-23H,2-10H2,1H3,(H,24,25)(H,26,27)(H,28,29);/t11?,12-,13+;/m1./s1 |
| InChIKey | HCFUPXCCKWYEME-VHBLZNKNSA-N |
| XLogP | -1.66 |
| TPSA | 185.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |