C36H69N5O8 — CID 126600140
tert-butyl 6-amino-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoate (PubChem CID 126600140) has the molecular formula C36H69N5O8 and a molecular weight of 699.98 g/mol. Its IUPAC name is tert-butyl 6-amino-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoate.
| Compound Name | tert-butyl 6-amino-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoate |
|---|---|
| PubChem CID | 126600140 |
| Molecular Formula | C36H69N5O8 |
| Molecular Weight | 699.98 g/mol |
| Exact Mass | 699.51 |
| IUPAC Name | tert-butyl 6-amino-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)OC(C)(C)C)CCN(C(CCCCN)C(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C36H69N5O8/c1-33(2,3)46-29(42)25-38-17-19-39(26-30(43)47-34(4,5)6)21-23-41(28(15-13-14-16-37)32(45)49-36(10,11)12)24-22-40(20-18-38)27-31(44)48-35(7,8)9/h28H,13-27,37H2,1-12H3 |
| InChIKey | JTKOWYGNEJSUFL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.98 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|