C26H48N4O8 — CID 71196259
dimethyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanedioate (PubChem CID 71196259) has the molecular formula C26H48N4O8 and a molecular weight of 544.69 g/mol. Its IUPAC name is dimethyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanedioate.
| Compound Name | dimethyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanedioate |
|---|---|
| PubChem CID | 71196259 |
| Molecular Formula | C26H48N4O8 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | dimethyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanedioate |
| SMILES | COC(=O)CC(C(=O)OC)N1CCNCCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H48N4O8/c1-25(2,3)37-22(32)18-28-11-9-27-10-12-30(20(24(34)36-8)17-21(31)35-7)16-15-29(14-13-28)19-23(33)38-26(4,5)6/h20,27H,9-19H2,1-8H3 |
| InChIKey | DJDNWMRRMHKTHN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|