C34H54F4N4O7 — CID 175481523
ethyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(1,2,3,3-tetrafluoropropoxy)phenyl]propanoate (PubChem CID 175481523) has the molecular formula C34H54F4N4O7 and a molecular weight of 706.82 g/mol. Its IUPAC name is ethyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(1,2,3,3-tetrafluoropropoxy)phenyl]propanoate.
| Compound Name | ethyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(1,2,3,3-tetrafluoropropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 175481523 |
| Molecular Formula | C34H54F4N4O7 |
| Molecular Weight | 706.82 g/mol |
| Exact Mass | 706.39 |
| IUPAC Name | ethyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(1,2,3,3-tetrafluoropropoxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC(F)C(F)C(F)F)cc1)N1CCN(CC(=O)OC(C)(C)C)CCNCCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C34H54F4N4O7/c1-8-46-32(45)26(21-24-9-11-25(12-10-24)47-31(38)29(35)30(36)37)42-19-17-40(22-27(43)48-33(2,3)4)15-13-39-14-16-41(18-20-42)23-28(44)49-34(5,6)7/h9-12,26,29-31,39H,8,13-23H2,1-7H3 |
| InChIKey | SDIVTCZQISDMDH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|