C26H50N4O6 — CID 23113355
butyl 2-[4,7-bis(2-butoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 23113355) has the molecular formula C26H50N4O6 and a molecular weight of 514.71 g/mol. Its IUPAC name is butyl 2-[4,7-bis(2-butoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | butyl 2-[4,7-bis(2-butoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 23113355 |
| Molecular Formula | C26H50N4O6 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | butyl 2-[4,7-bis(2-butoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CCCCOC(=O)CN1CCNCCN(CC(=O)OCCCC)CCN(CC(=O)OCCCC)CC1 |
| InChI | InChI=1S/C26H50N4O6/c1-4-7-18-34-24(31)21-28-12-10-27-11-13-29(22-25(32)35-19-8-5-2)15-17-30(16-14-28)23-26(33)36-20-9-6-3/h27H,4-23H2,1-3H3 |
| InChIKey | LZHAHSVYPRELLW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|