C13H21F3N2O3 — CID 86869708
butyl 2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetate (PubChem CID 86869708) has the molecular formula C13H21F3N2O3 and a molecular weight of 310.32 g/mol. Its IUPAC name is butyl 2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetate.
| Compound Name | butyl 2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 86869708 |
| Molecular Formula | C13H21F3N2O3 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | butyl 2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetate |
| SMILES | CCCCOC(=O)CN1CCN(C(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3N2O3/c1-2-3-8-21-12(20)10-17-4-6-18(7-5-17)11(19)9-13(14,15)16/h2-10H2,1H3 |
| InChIKey | LSRVEIMIJRDQAZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|