C18H34N4O6 — CID 57277567
2-[7-(2-butoxy-2-oxoethyl)-10-(carboxymethyl)-4,5,5-tritritio-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 57277567) has the molecular formula C18H34N4O6 and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-[7-(2-butoxy-2-oxoethyl)-10-(carboxymethyl)-4,5,5-tritritio-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-(2-butoxy-2-oxoethyl)-10-(carboxymethyl)-4,5,5-tritritio-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 57277567 |
| Molecular Formula | C18H34N4O6 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 2-[7-(2-butoxy-2-oxoethyl)-10-(carboxymethyl)-4,5,5-tritritio-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | [3H]N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)OCCCC)CC1([3H])[3H] |
| InChI | InChI=1S/C18H34N4O6/c1-2-3-12-28-18(27)15-21-7-5-19-4-6-20(13-16(23)24)8-10-22(11-9-21)14-17(25)26/h19H,2-15H2,1H3,(H,23,24)(H,25,26)/i5T2/hT |
| InChIKey | AGLKFWVJYCSFSY-AYSYXMBFSA-N |
| XLogP | -0.99 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|