C12H24N2O2 — CID 62823071
pentyl 2-(1,4-diazepan-1-yl)acetate (PubChem CID 62823071) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is pentyl 2-(1,4-diazepan-1-yl)acetate.
| Compound Name | pentyl 2-(1,4-diazepan-1-yl)acetate |
|---|---|
| PubChem CID | 62823071 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | pentyl 2-(1,4-diazepan-1-yl)acetate |
| SMILES | CCCCCOC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C12H24N2O2/c1-2-3-4-10-16-12(15)11-14-8-5-6-13-7-9-14/h13H,2-11H2,1H3 |
| InChIKey | CGXWWORYXWSKSB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|