About 2-piperazin-1-ylacetyl iodide
2-piperazin-1-ylacetyl iodide (PubChem CID 153235141) has the molecular formula C6H11IN2O
and a molecular weight of 254.07 g/mol. Its IUPAC name is 2-piperazin-1-ylacetyl iodide.
Molecular Properties
| Compound Name | 2-piperazin-1-ylacetyl iodide |
| PubChem CID | 153235141 |
| Molecular Formula | C6H11IN2O |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 2-piperazin-1-ylacetyl iodide |
| SMILES | O=C(I)CN1CCNCC1 |
| InChI | InChI=1S/C6H11IN2O/c7-6(10)5-9-3-1-8-2-4-9/h8H,1-5H2 |
| InChIKey | WQIKBBAZGQMVDD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-piperazin-1-ylacetyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylacetyl iodide?
The IUPAC name of 2-piperazin-1-ylacetyl iodide (CID 153235141) is 2-piperazin-1-ylacetyl iodide.
What is the SMILES notation for 2-piperazin-1-ylacetyl iodide?
The canonical SMILES for 2-piperazin-1-ylacetyl iodide is O=C(I)CN1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylacetyl iodide?
The InChIKey is WQIKBBAZGQMVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11IN2O/c7-6(10)5-9-3-1-8-2-4-9/h8H,1-5H2.
What are the key properties of 2-piperazin-1-ylacetyl iodide?
2-piperazin-1-ylacetyl iodide has a molecular weight of 254.07 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylacetyl iodide is sourced from PubChem (CID 153235141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).