C10H22Cl2N2O — CID 43810585
3,3-dimethyl-1-piperazin-1-ylbutan-2-one;dihydrochloride (PubChem CID 43810585) has the molecular formula C10H22Cl2N2O and a molecular weight of 257.20 g/mol. Its IUPAC name is 3,3-dimethyl-1-piperazin-1-ylbutan-2-one;dihydrochloride.
| Compound Name | 3,3-dimethyl-1-piperazin-1-ylbutan-2-one;dihydrochloride |
|---|---|
| PubChem CID | 43810585 |
| Molecular Formula | C10H22Cl2N2O |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3,3-dimethyl-1-piperazin-1-ylbutan-2-one;dihydrochloride |
| SMILES | CC(C)(C)C(=O)CN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C10H20N2O.2ClH/c1-10(2,3)9(13)8-12-6-4-11-5-7-12;;/h11H,4-8H2,1-3H3;2*1H |
| InChIKey | LFJQCFOIZCTBIB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |