C13H26N4O2 — CID 53487771
prop-2-enyl 2-(1,4,7,10-tetrazacyclododec-1-yl)acetate (PubChem CID 53487771) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is prop-2-enyl 2-(1,4,7,10-tetrazacyclododec-1-yl)acetate.
| Compound Name | prop-2-enyl 2-(1,4,7,10-tetrazacyclododec-1-yl)acetate |
|---|---|
| PubChem CID | 53487771 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | prop-2-enyl 2-(1,4,7,10-tetrazacyclododec-1-yl)acetate |
| SMILES | C=CCOC(=O)CN1CCNCCNCCNCC1 |
| InChI | InChI=1S/C13H26N4O2/c1-2-11-19-13(18)12-17-9-7-15-5-3-14-4-6-16-8-10-17/h2,14-16H,1,3-12H2 |
| InChIKey | MLBRGPOWBHLFRF-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|