About oxolan-3-ylmethyl 2-piperazin-1-ylacetate
oxolan-3-ylmethyl 2-piperazin-1-ylacetate (PubChem CID 62311858) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is oxolan-3-ylmethyl 2-piperazin-1-ylacetate.
Molecular Properties
| Compound Name | oxolan-3-ylmethyl 2-piperazin-1-ylacetate |
| PubChem CID | 62311858 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | oxolan-3-ylmethyl 2-piperazin-1-ylacetate |
| SMILES | O=C(CN1CCNCC1)OCC1CCOC1 |
| InChI | InChI=1S/C11H20N2O3/c14-11(7-13-4-2-12-3-5-13)16-9-10-1-6-15-8-10/h10,12H,1-9H2 |
| InChIKey | DMFMZKCTHBPDQU-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxolan-3-ylmethyl 2-piperazin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-ylmethyl 2-piperazin-1-ylacetate?
The IUPAC name of oxolan-3-ylmethyl 2-piperazin-1-ylacetate (CID 62311858) is oxolan-3-ylmethyl 2-piperazin-1-ylacetate.
What is the SMILES notation for oxolan-3-ylmethyl 2-piperazin-1-ylacetate?
The canonical SMILES for oxolan-3-ylmethyl 2-piperazin-1-ylacetate is O=C(CN1CCNCC1)OCC1CCOC1.
What is the InChIKey of oxolan-3-ylmethyl 2-piperazin-1-ylacetate?
The InChIKey is DMFMZKCTHBPDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c14-11(7-13-4-2-12-3-5-13)16-9-10-1-6-15-8-10/h10,12H,1-9H2.
What are the key properties of oxolan-3-ylmethyl 2-piperazin-1-ylacetate?
oxolan-3-ylmethyl 2-piperazin-1-ylacetate has a molecular weight of 228.29 g/mol, XLogP of -0.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-ylmethyl 2-piperazin-1-ylacetate is sourced from PubChem (CID 62311858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).