C10H20N2O2 — CID 130542390
1-(oxolan-3-ylmethyl)-1,4-diazepan-6-ol (PubChem CID 130542390) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(oxolan-3-ylmethyl)-1,4-diazepan-6-ol.
| Compound Name | 1-(oxolan-3-ylmethyl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 130542390 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-(oxolan-3-ylmethyl)-1,4-diazepan-6-ol |
| SMILES | OC1CNCCN(CC2CCOC2)C1 |
| InChI | InChI=1S/C10H20N2O2/c13-10-5-11-2-3-12(7-10)6-9-1-4-14-8-9/h9-11,13H,1-8H2 |
| InChIKey | LCTHZMYMVPBCJJ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |