About oxolan-3-ylmethyl 3-(ethylamino)propanoate
oxolan-3-ylmethyl 3-(ethylamino)propanoate (PubChem CID 62329002) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is oxolan-3-ylmethyl 3-(ethylamino)propanoate.
Molecular Properties
| Compound Name | oxolan-3-ylmethyl 3-(ethylamino)propanoate |
| PubChem CID | 62329002 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | oxolan-3-ylmethyl 3-(ethylamino)propanoate |
| SMILES | CCNCCC(=O)OCC1CCOC1 |
| InChI | InChI=1S/C10H19NO3/c1-2-11-5-3-10(12)14-8-9-4-6-13-7-9/h9,11H,2-8H2,1H3 |
| InChIKey | NZTUTKKDRDXTHR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-ylmethyl 3-(ethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-ylmethyl 3-(ethylamino)propanoate?
The IUPAC name of oxolan-3-ylmethyl 3-(ethylamino)propanoate (CID 62329002) is oxolan-3-ylmethyl 3-(ethylamino)propanoate.
What is the SMILES notation for oxolan-3-ylmethyl 3-(ethylamino)propanoate?
The canonical SMILES for oxolan-3-ylmethyl 3-(ethylamino)propanoate is CCNCCC(=O)OCC1CCOC1.
What is the InChIKey of oxolan-3-ylmethyl 3-(ethylamino)propanoate?
The InChIKey is NZTUTKKDRDXTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-11-5-3-10(12)14-8-9-4-6-13-7-9/h9,11H,2-8H2,1H3.
What are the key properties of oxolan-3-ylmethyl 3-(ethylamino)propanoate?
oxolan-3-ylmethyl 3-(ethylamino)propanoate has a molecular weight of 201.27 g/mol, XLogP of 0.57, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-ylmethyl 3-(ethylamino)propanoate is sourced from PubChem (CID 62329002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).