About oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate
oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate (PubChem CID 61316757) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate.
Molecular Properties
| Compound Name | oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate |
| PubChem CID | 61316757 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate |
| SMILES | Nc1ccc(OCCC(=O)OCC2CCOC2)cc1 |
| InChI | InChI=1S/C14H19NO4/c15-12-1-3-13(4-2-12)18-8-6-14(16)19-10-11-5-7-17-9-11/h1-4,11H,5-10,15H2 |
| InChIKey | KWXLAAFNEOQXEV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate?
The IUPAC name of oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate (CID 61316757) is oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate.
What is the SMILES notation for oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate?
The canonical SMILES for oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate is Nc1ccc(OCCC(=O)OCC2CCOC2)cc1.
What is the InChIKey of oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate?
The InChIKey is KWXLAAFNEOQXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c15-12-1-3-13(4-2-12)18-8-6-14(16)19-10-11-5-7-17-9-11/h1-4,11H,5-10,15H2.
What are the key properties of oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate?
oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate has a molecular weight of 265.31 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-ylmethyl 3-(4-aminophenoxy)propanoate is sourced from PubChem (CID 61316757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).