C16H23NO4 — CID 116523238
(5,5-dimethyloxolan-2-yl)methyl 3-(4-aminophenoxy)propanoate (PubChem CID 116523238) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (5,5-dimethyloxolan-2-yl)methyl 3-(4-aminophenoxy)propanoate.
| Compound Name | (5,5-dimethyloxolan-2-yl)methyl 3-(4-aminophenoxy)propanoate |
|---|---|
| PubChem CID | 116523238 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (5,5-dimethyloxolan-2-yl)methyl 3-(4-aminophenoxy)propanoate |
| SMILES | CC1(C)CCC(COC(=O)CCOc2ccc(N)cc2)O1 |
| InChI | InChI=1S/C16H23NO4/c1-16(2)9-7-14(21-16)11-20-15(18)8-10-19-13-5-3-12(17)4-6-13/h3-6,14H,7-11,17H2,1-2H3 |
| InChIKey | YRBWZSGZUOCGAV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|