C16H24O3 — CID 104889581
(1R)-1-[4-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]propan-1-ol (PubChem CID 104889581) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1R)-1-[4-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]propan-1-ol.
| Compound Name | (1R)-1-[4-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 104889581 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R)-1-[4-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccc(OCC2CCC(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H24O3/c1-4-15(17)12-5-7-13(8-6-12)18-11-14-9-10-16(2,3)19-14/h5-8,14-15,17H,4,9-11H2,1-3H3/t14?,15-/m1/s1 |
| InChIKey | GAXNTNQROXJOOC-YSSOQSIOSA-N |
| XLogP | 3.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |