C11H19N — CID 144835688
1-[(3E)-3-methylhexa-3,5-dienyl]pyrrolidine (PubChem CID 144835688) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-[(3E)-3-methylhexa-3,5-dienyl]pyrrolidine.
| Compound Name | 1-[(3E)-3-methylhexa-3,5-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 144835688 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-[(3E)-3-methylhexa-3,5-dienyl]pyrrolidine |
| SMILES | C=C/C=C(\C)CCN1CCCC1 |
| InChI | InChI=1S/C11H19N/c1-3-6-11(2)7-10-12-8-4-5-9-12/h3,6H,1,4-5,7-10H2,2H3/b11-6+ |
| InChIKey | HOWHBMQWJDRQST-IZZDOVSWSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|