C13H21NO — CID 142819065
1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]pyrrolidine (PubChem CID 142819065) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]pyrrolidine.
| Compound Name | 1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]pyrrolidine |
|---|---|
| PubChem CID | 142819065 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyethyl]pyrrolidine |
| SMILES | C=C/C=C(\C=C/C)OCCN1CCCC1 |
| InChI | InChI=1S/C13H21NO/c1-3-7-13(8-4-2)15-12-11-14-9-5-6-10-14/h3-4,7-8H,1,5-6,9-12H2,2H3/b8-4-,13-7+ |
| InChIKey | SPLUJUMLONKBTE-UYPGYXLJSA-N |
| XLogP | 2.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|