C21H33NO2 — CID 146527891
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]-4-methylpiperidine (PubChem CID 146527891) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]-4-methylpiperidine.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 146527891 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hexa-2,4-dien-3-yl]oxyethyl]-4-methylpiperidine |
| SMILES | C=C/C=C(\C=C/C)OC1(C)CCN(CCOC(/C=C\C)=C/C)CC1 |
| InChI | InChI=1S/C21H33NO2/c1-6-10-19(9-4)23-18-17-22-15-13-21(5,14-16-22)24-20(11-7-2)12-8-3/h6-12H,2,13-18H2,1,3-5H3/b10-6-,12-8-,19-9+,20-11+ |
| InChIKey | YIYYOQXIYRPRFR-DWNJYWBNSA-N |
| XLogP | 5.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|