C14H23NO2 — CID 145107636
[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol (PubChem CID 145107636) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is [1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol.
| Compound Name | [1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 145107636 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | [1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol |
| SMILES | C=C/C=C(\C=C)OCCN1CCC(CO)CC1 |
| InChI | InChI=1S/C14H23NO2/c1-3-5-14(4-2)17-11-10-15-8-6-13(12-16)7-9-15/h3-5,13,16H,1-2,6-12H2/b14-5+ |
| InChIKey | KFOOOPDUMZIQLZ-LHHJGKSTSA-N |
| XLogP | 1.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|