C28H39N3O3 — CID 145107692
(Z)-1-(1,3-benzodioxol-5-yl)-N-[[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine (PubChem CID 145107692) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is (Z)-1-(1,3-benzodioxol-5-yl)-N-[[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine.
| Compound Name | (Z)-1-(1,3-benzodioxol-5-yl)-N-[[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine |
|---|---|
| PubChem CID | 145107692 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | (Z)-1-(1,3-benzodioxol-5-yl)-N-[[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine |
| SMILES | C=C/C=C(\C=C)OCCN1CCC(CNC(C(/C=C\CC)=N/C)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C28H39N3O3/c1-5-8-10-25(29-4)28(23-11-12-26-27(19-23)34-21-33-26)30-20-22-13-15-31(16-14-22)17-18-32-24(7-3)9-6-2/h6-12,19,22,28,30H,2-3,5,13-18,20-21H2,1,4H3/b10-8-,24-9+,29-25+ |
| InChIKey | OBZVWEAHUMGKRS-FYFJQUDQSA-N |
| XLogP | 5.07 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|