C14H26O2 — CID 143407124
ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxymethyl]oxirane (PubChem CID 143407124) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxymethyl]oxirane.
| Compound Name | ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 143407124 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | ethane;2-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxymethyl]oxirane |
| SMILES | C=C/C=C(\C=C/C)OCC1CO1.CC.CC |
| InChI | InChI=1S/C10H14O2.2C2H6/c1-3-5-9(6-4-2)11-7-10-8-12-10;2*1-2/h3-6,10H,1,7-8H2,2H3;2*1-2H3/b6-4-,9-5+;; |
| InChIKey | FBKVLIREUNNRGW-RYIOGPIUSA-N |
| XLogP | 4.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|