C9H14O2 — CID 122500456
2-[[(2E)-4-methylpenta-2,4-dien-2-yl]oxymethyl]oxirane (PubChem CID 122500456) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-[[(2E)-4-methylpenta-2,4-dien-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(2E)-4-methylpenta-2,4-dien-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 122500456 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-[[(2E)-4-methylpenta-2,4-dien-2-yl]oxymethyl]oxirane |
| SMILES | C=C(C)/C=C(\C)OCC1CO1 |
| InChI | InChI=1S/C9H14O2/c1-7(2)4-8(3)10-5-9-6-11-9/h4,9H,1,5-6H2,2-3H3/b8-4+ |
| InChIKey | WFYUZFQQSJDUFD-XBXARRHUSA-N |
| XLogP | 1.88 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|