C9H11ClO3 — CID 174397183
oxiran-2-ylmethyl 4-chloro-2-methylpenta-2,4-dienoate (PubChem CID 174397183) has the molecular formula C9H11ClO3 and a molecular weight of 202.64 g/mol. Its IUPAC name is oxiran-2-ylmethyl 4-chloro-2-methylpenta-2,4-dienoate.
| Compound Name | oxiran-2-ylmethyl 4-chloro-2-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 174397183 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | oxiran-2-ylmethyl 4-chloro-2-methylpenta-2,4-dienoate |
| SMILES | C=C(Cl)C=C(C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C9H11ClO3/c1-6(3-7(2)10)9(11)13-5-8-4-12-8/h3,8H,2,4-5H2,1H3 |
| InChIKey | JIMQELVSWHCSDO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|