C23H32O4 — CID 146245836
2-[[(1E,2Z,6E,7Z)-1,6-di(ethylidene)-5,5-dimethyl-4-methylidene-9-(oxiran-2-ylmethoxy)deca-2,7,9-trienoxy]methyl]oxirane (PubChem CID 146245836) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[[(1E,2Z,6E,7Z)-1,6-di(ethylidene)-5,5-dimethyl-4-methylidene-9-(oxiran-2-ylmethoxy)deca-2,7,9-trienoxy]methyl]oxirane.
| Compound Name | 2-[[(1E,2Z,6E,7Z)-1,6-di(ethylidene)-5,5-dimethyl-4-methylidene-9-(oxiran-2-ylmethoxy)deca-2,7,9-trienoxy]methyl]oxirane |
|---|---|
| PubChem CID | 146245836 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[[(1E,2Z,6E,7Z)-1,6-di(ethylidene)-5,5-dimethyl-4-methylidene-9-(oxiran-2-ylmethoxy)deca-2,7,9-trienoxy]methyl]oxirane |
| SMILES | C=C(/C=C\C(=C/C)C(C)(C)C(=C)/C=C\C(=C/C)OCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C23H32O4/c1-7-19(11-10-18(4)24-13-21-15-26-21)23(5,6)17(3)9-12-20(8-2)25-14-22-16-27-22/h7-12,21-22H,3-4,13-16H2,1-2,5-6H3/b11-10-,12-9-,19-7+,20-8+ |
| InChIKey | CKCYDTSWXMLUHN-KWCXYQAQSA-N |
| XLogP | 4.88 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|