C20H26O2 — CID 144588993
2-[[4-[(4Z,6Z)-2,6-dimethyl-3-methylideneocta-4,6-dien-2-yl]phenoxy]methyl]oxirane (PubChem CID 144588993) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[[4-[(4Z,6Z)-2,6-dimethyl-3-methylideneocta-4,6-dien-2-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[(4Z,6Z)-2,6-dimethyl-3-methylideneocta-4,6-dien-2-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 144588993 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[[4-[(4Z,6Z)-2,6-dimethyl-3-methylideneocta-4,6-dien-2-yl]phenoxy]methyl]oxirane |
| SMILES | C=C(/C=C\C(C)=C/C)C(C)(C)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C20H26O2/c1-6-15(2)7-8-16(3)20(4,5)17-9-11-18(12-10-17)21-13-19-14-22-19/h6-12,19H,3,13-14H2,1-2,4-5H3/b8-7-,15-6- |
| InChIKey | PLWADENDMFSUCP-APLQTJKCSA-N |
| XLogP | 4.82 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|