C21H28O4 — CID 163487969
2-[[4-[(Z,3E)-3-ethylidene-2-methyl-6-(oxiran-2-ylmethoxy)hex-4-en-2-yl]phenoxy]methyl]oxirane (PubChem CID 163487969) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[[4-[(Z,3E)-3-ethylidene-2-methyl-6-(oxiran-2-ylmethoxy)hex-4-en-2-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[(Z,3E)-3-ethylidene-2-methyl-6-(oxiran-2-ylmethoxy)hex-4-en-2-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 163487969 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[[4-[(Z,3E)-3-ethylidene-2-methyl-6-(oxiran-2-ylmethoxy)hex-4-en-2-yl]phenoxy]methyl]oxirane |
| SMILES | C/C=C(\C=C/COCC1CO1)C(C)(C)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C21H28O4/c1-4-16(6-5-11-22-12-19-13-24-19)21(2,3)17-7-9-18(10-8-17)23-14-20-15-25-20/h4-10,19-20H,11-15H2,1-3H3/b6-5-,16-4+ |
| InChIKey | CKEDXHOCTKFKQO-QRHXCOLQSA-N |
| XLogP | 3.66 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|