C29H44O3 — CID 162006543
4-tert-butyl-2,6-di(propan-2-yl)phenol;2-[(4-tert-butylphenoxy)methyl]oxirane (PubChem CID 162006543) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is 4-tert-butyl-2,6-di(propan-2-yl)phenol;2-[(4-tert-butylphenoxy)methyl]oxirane.
| Compound Name | 4-tert-butyl-2,6-di(propan-2-yl)phenol;2-[(4-tert-butylphenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 162006543 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 4-tert-butyl-2,6-di(propan-2-yl)phenol;2-[(4-tert-butylphenoxy)methyl]oxirane |
| SMILES | CC(C)(C)c1ccc(OCC2CO2)cc1.CC(C)c1cc(C(C)(C)C)cc(C(C)C)c1O |
| InChI | InChI=1S/C16H26O.C13H18O2/c1-10(2)13-8-12(16(5,6)7)9-14(11(3)4)15(13)17;1-13(2,3)10-4-6-11(7-5-10)14-8-12-9-15-12/h8-11,17H,1-7H3;4-7,12H,8-9H2,1-3H3 |
| InChIKey | YSXHPEXHSFKCTJ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|