C36H44O6 — CID 54048313
2-[[4-[bis[5-tert-butyl-2-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane (PubChem CID 54048313) has the molecular formula C36H44O6 and a molecular weight of 572.74 g/mol. Its IUPAC name is 2-[[4-[bis[5-tert-butyl-2-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[bis[5-tert-butyl-2-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 54048313 |
| Molecular Formula | C36H44O6 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 2-[[4-[bis[5-tert-butyl-2-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane |
| SMILES | CC(C)(C)c1ccc(OCC2CO2)c(C(c2ccc(OCC3CO3)cc2)c2cc(C(C)(C)C)ccc2OCC2CO2)c1 |
| InChI | InChI=1S/C36H44O6/c1-35(2,3)24-9-13-32(41-21-28-19-39-28)30(15-24)34(23-7-11-26(12-8-23)37-17-27-18-38-27)31-16-25(36(4,5)6)10-14-33(31)42-22-29-20-40-29/h7-16,27-29,34H,17-22H2,1-6H3 |
| InChIKey | LRCSWYPDZABCQT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|