C18H28O2 — CID 123926439
2-[[4-(2,5,5-trimethylhexan-3-yl)phenoxy]methyl]oxirane (PubChem CID 123926439) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[[4-(2,5,5-trimethylhexan-3-yl)phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-(2,5,5-trimethylhexan-3-yl)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 123926439 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-[[4-(2,5,5-trimethylhexan-3-yl)phenoxy]methyl]oxirane |
| SMILES | CC(C)C(CC(C)(C)C)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C18H28O2/c1-13(2)17(10-18(3,4)5)14-6-8-15(9-7-14)19-11-16-12-20-16/h6-9,13,16-17H,10-12H2,1-5H3 |
| InChIKey | GFUFBCGWTLQYMB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|