C28H40O4 — CID 145004812
2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane;3,3,5-trimethylheptane (PubChem CID 145004812) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is 2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane;3,3,5-trimethylheptane.
| Compound Name | 2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane;3,3,5-trimethylheptane |
|---|---|
| PubChem CID | 145004812 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane;3,3,5-trimethylheptane |
| SMILES | CCC(C)CC(C)(C)CC.c1cc(-c2ccc(OCC3CO3)cc2)ccc1OCC1CO1 |
| InChI | InChI=1S/C18H18O4.C10H22/c1-5-15(19-9-17-11-21-17)6-2-13(1)14-3-7-16(8-4-14)20-10-18-12-22-18;1-6-9(3)8-10(4,5)7-2/h1-8,17-18H,9-12H2;9H,6-8H2,1-5H3 |
| InChIKey | POSTYWZYOHIBSM-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|