C28H28O6 — CID 130316322
2-[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane (PubChem CID 130316322) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane.
| Compound Name | 2-[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane |
|---|---|
| PubChem CID | 130316322 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane |
| SMILES | c1cc(C(c2ccc(OCC3CO3)cc2)c2ccc(OC3CCO3)cc2)ccc1OCC1CO1 |
| InChI | InChI=1S/C28H28O6/c1-7-22(30-15-25-17-32-25)8-2-19(1)28(20-3-9-23(10-4-20)31-16-26-18-33-26)21-5-11-24(12-6-21)34-27-13-14-29-27/h1-12,25-28H,13-18H2 |
| InChIKey | JUWWBNFCUXOKFV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|