C46H52O8 — CID 163718211
2-[4-[[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]-4-methylcycloheptyl]-[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane (PubChem CID 163718211) has the molecular formula C46H52O8 and a molecular weight of 732.91 g/mol. Its IUPAC name is 2-[4-[[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]-4-methylcycloheptyl]-[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane.
| Compound Name | 2-[4-[[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]-4-methylcycloheptyl]-[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane |
|---|---|
| PubChem CID | 163718211 |
| Molecular Formula | C46H52O8 |
| Molecular Weight | 732.91 g/mol |
| Exact Mass | 732.37 |
| IUPAC Name | 2-[4-[[4-[bis[4-(oxiran-2-ylmethoxy)phenyl]methyl]-4-methylcycloheptyl]-[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]oxetane |
| SMILES | CC1(C(c2ccc(OCC3CO3)cc2)c2ccc(OCC3CO3)cc2)CCCC(C(c2ccc(OCC3CO3)cc2)c2ccc(OC3CCO3)cc2)CC1 |
| InChI | InChI=1S/C46H52O8/c1-46(45(34-8-14-37(15-9-34)49-26-41-29-52-41)35-10-16-38(17-11-35)50-27-42-30-53-42)22-2-3-31(20-23-46)44(32-4-12-36(13-5-32)48-25-40-28-51-40)33-6-18-39(19-7-33)54-43-21-24-47-43/h4-19,31,40-45H,2-3,20-30H2,1H3 |
| InChIKey | KPFGKAISNTUBCC-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 83.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.91 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|