C10H14O2 — CID 89283730
2-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]oxirane (PubChem CID 89283730) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]oxirane.
| Compound Name | 2-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 89283730 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxymethyl]oxirane |
| SMILES | C=C/C(=C\C=C/C)OCC1CO1 |
| InChI | InChI=1S/C10H14O2/c1-3-5-6-9(4-2)11-7-10-8-12-10/h3-6,10H,2,7-8H2,1H3/b5-3-,9-6+ |
| InChIKey | YUMQIBSHYFQRLY-PAEKIZANSA-N |
| XLogP | 2.05 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|