C10H15NO5 — CID 159926825
N-(hydroxymethyl)prop-2-enamide;oxiran-2-ylmethyl prop-2-enoate (PubChem CID 159926825) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is N-(hydroxymethyl)prop-2-enamide;oxiran-2-ylmethyl prop-2-enoate.
| Compound Name | N-(hydroxymethyl)prop-2-enamide;oxiran-2-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 159926825 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-(hydroxymethyl)prop-2-enamide;oxiran-2-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)NCO.C=CC(=O)OCC1CO1 |
| InChI | InChI=1S/C6H8O3.C4H7NO2/c1-2-6(7)9-4-5-3-8-5;1-2-4(7)5-3-6/h2,5H,1,3-4H2;2,6H,1,3H2,(H,5,7) |
| InChIKey | NZCUVJAAAVMINK-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|