C15H22O6 — CID 158801899
2-[2-(oxiran-2-yl)ethylidene]pentanoic acid;oxiran-2-ylmethyl prop-2-enoate (PubChem CID 158801899) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[2-(oxiran-2-yl)ethylidene]pentanoic acid;oxiran-2-ylmethyl prop-2-enoate.
| Compound Name | 2-[2-(oxiran-2-yl)ethylidene]pentanoic acid;oxiran-2-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 158801899 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[2-(oxiran-2-yl)ethylidene]pentanoic acid;oxiran-2-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CO1.CCCC(=CCC1CO1)C(=O)O |
| InChI | InChI=1S/C9H14O3.C6H8O3/c1-2-3-7(9(10)11)4-5-8-6-12-8;1-2-6(7)9-4-5-3-8-5/h4,8H,2-3,5-6H2,1H3,(H,10,11);2,5H,1,3-4H2 |
| InChIKey | ITPADZHYWWUJBU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|