C16H26O5 — CID 87658267
butyl prop-2-enoate;ethene;2-methylidene-4-(oxiran-2-yl)butanoic acid (PubChem CID 87658267) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is butyl prop-2-enoate;ethene;2-methylidene-4-(oxiran-2-yl)butanoic acid.
| Compound Name | butyl prop-2-enoate;ethene;2-methylidene-4-(oxiran-2-yl)butanoic acid |
|---|---|
| PubChem CID | 87658267 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | butyl prop-2-enoate;ethene;2-methylidene-4-(oxiran-2-yl)butanoic acid |
| SMILES | C=C.C=C(CCC1CO1)C(=O)O.C=CC(=O)OCCCC |
| InChI | InChI=1S/C7H10O3.C7H12O2.C2H4/c1-5(7(8)9)2-3-6-4-10-6;1-3-5-6-9-7(8)4-2;1-2/h6H,1-4H2,(H,8,9);4H,2-3,5-6H2,1H3;1-2H2 |
| InChIKey | QSDUFOOXPBJBRS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|