C12H16O6 — CID 158651798
oxiran-2-ylmethyl prop-2-enoate;3-propyloxirene-2-carboxylic acid (PubChem CID 158651798) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is oxiran-2-ylmethyl prop-2-enoate;3-propyloxirene-2-carboxylic acid.
| Compound Name | oxiran-2-ylmethyl prop-2-enoate;3-propyloxirene-2-carboxylic acid |
|---|---|
| PubChem CID | 158651798 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | oxiran-2-ylmethyl prop-2-enoate;3-propyloxirene-2-carboxylic acid |
| SMILES | C=CC(=O)OCC1CO1.CCCC1=C(C(=O)O)O1 |
| InChI | InChI=1S/2C6H8O3/c1-2-6(7)9-4-5-3-8-5;1-2-3-4-5(9-4)6(7)8/h2,5H,1,3-4H2;2-3H2,1H3,(H,7,8) |
| InChIKey | IBQLGVHCBODIIU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|