C14H23NO5 — CID 174862002
oxiran-2-ylmethyl prop-2-enoate;propyl 2-(methylaminomethyl)prop-2-enoate (PubChem CID 174862002) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is oxiran-2-ylmethyl prop-2-enoate;propyl 2-(methylaminomethyl)prop-2-enoate.
| Compound Name | oxiran-2-ylmethyl prop-2-enoate;propyl 2-(methylaminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 174862002 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | oxiran-2-ylmethyl prop-2-enoate;propyl 2-(methylaminomethyl)prop-2-enoate |
| SMILES | C=C(CNC)C(=O)OCCC.C=CC(=O)OCC1CO1 |
| InChI | InChI=1S/C8H15NO2.C6H8O3/c1-4-5-11-8(10)7(2)6-9-3;1-2-6(7)9-4-5-3-8-5/h9H,2,4-6H2,1,3H3;2,5H,1,3-4H2 |
| InChIKey | BWFXEMDMCZBDIB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|