C11H16O — CID 178055171
[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycyclobutane (PubChem CID 178055171) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycyclobutane.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycyclobutane |
|---|---|
| PubChem CID | 178055171 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycyclobutane |
| SMILES | C=C/C(=C\C=C/C)OC1CCC1 |
| InChI | InChI=1S/C11H16O/c1-3-5-7-10(4-2)12-11-8-6-9-11/h3-5,7,11H,2,6,8-9H2,1H3/b5-3-,10-7+ |
| InChIKey | CIUBFWNWBRZWAQ-ZMSZASLQSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|