C12H22O — CID 143474027
ethane;(3E,5Z)-3-propan-2-yloxyhepta-1,3,5-triene (PubChem CID 143474027) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;(3E,5Z)-3-propan-2-yloxyhepta-1,3,5-triene.
| Compound Name | ethane;(3E,5Z)-3-propan-2-yloxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143474027 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | ethane;(3E,5Z)-3-propan-2-yloxyhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C/C)OC(C)C.CC |
| InChI | InChI=1S/C10H16O.C2H6/c1-5-7-8-10(6-2)11-9(3)4;1-2/h5-9H,2H2,1,3-4H3;1-2H3/b7-5-,10-8+; |
| InChIKey | FQNOETJFNHWLDR-PJVFXYKKSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|