C16H30O — CID 143462640
ethane;(2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene (PubChem CID 143462640) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is ethane;(2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene.
| Compound Name | ethane;(2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene |
|---|---|
| PubChem CID | 143462640 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | ethane;(2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene |
| SMILES | C/C=C\C=C(/C=C\C)OC(C)C(C)CC.CC |
| InChI | InChI=1S/C14H24O.C2H6/c1-6-9-11-14(10-7-2)15-13(5)12(4)8-3;1-2/h6-7,9-13H,8H2,1-5H3;1-2H3/b9-6-,10-7-,14-11+; |
| InChIKey | MQPUUWSUARLVSK-FMHVDRCNSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|