C16H28S — CID 167166920
(2Z,4E,6Z)-4-(1-ethylsulfanyl-3,3-dimethylbutan-2-yl)octa-2,4,6-triene (PubChem CID 167166920) has the molecular formula C16H28S and a molecular weight of 252.47 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-(1-ethylsulfanyl-3,3-dimethylbutan-2-yl)octa-2,4,6-triene.
| Compound Name | (2Z,4E,6Z)-4-(1-ethylsulfanyl-3,3-dimethylbutan-2-yl)octa-2,4,6-triene |
|---|---|
| PubChem CID | 167166920 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (2Z,4E,6Z)-4-(1-ethylsulfanyl-3,3-dimethylbutan-2-yl)octa-2,4,6-triene |
| SMILES | C/C=C\C=C(/C=C\C)C(CSCC)C(C)(C)C |
| InChI | InChI=1S/C16H28S/c1-7-10-12-14(11-8-2)15(13-17-9-3)16(4,5)6/h7-8,10-12,15H,9,13H2,1-6H3/b10-7-,11-8-,14-12+ |
| InChIKey | GOFQPYXKTAIVET-KPXPOWFASA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|