C16H27F2P — CID 143948641
[(5E,7Z)-4-tert-butyl-7,8-difluoro-2-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-yl]phosphane (PubChem CID 143948641) has the molecular formula C16H27F2P and a molecular weight of 288.36 g/mol. Its IUPAC name is [(5E,7Z)-4-tert-butyl-7,8-difluoro-2-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-yl]phosphane.
| Compound Name | [(5E,7Z)-4-tert-butyl-7,8-difluoro-2-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-yl]phosphane |
|---|---|
| PubChem CID | 143948641 |
| Molecular Formula | C16H27F2P |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [(5E,7Z)-4-tert-butyl-7,8-difluoro-2-methyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-yl]phosphane |
| SMILES | C/C=C\C(=C/C(F)=C/F)C(CC(C)(C)P)C(C)(C)C |
| InChI | InChI=1S/C16H27F2P/c1-7-8-12(9-13(18)11-17)14(15(2,3)4)10-16(5,6)19/h7-9,11,14H,10,19H2,1-6H3/b8-7-,12-9+,13-11- |
| InChIKey | IFQGPDNOGRZCPB-UOVRLWSVSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|