About [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane
[2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane (PubChem CID 123933060) has the molecular formula C13H31P3
and a molecular weight of 280.31 g/mol. Its IUPAC name is [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane.
Molecular Properties
| Compound Name | [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane |
| PubChem CID | 123933060 |
| Molecular Formula | C13H31P3 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane |
| SMILES | CC(C)(P)CC(CC(C)(C)P)CC(C)(C)P |
| InChI | InChI=1S/C13H31P3/c1-11(2,14)7-10(8-12(3,4)15)9-13(5,6)16/h10H,7-9,14-16H2,1-6H3 |
| InChIKey | NTGZFTFQKNLHMB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane?
The IUPAC name of [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane (CID 123933060) is [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane.
What is the SMILES notation for [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane?
The canonical SMILES for [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane is CC(C)(P)CC(CC(C)(C)P)CC(C)(C)P.
What is the InChIKey of [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane?
The InChIKey is NTGZFTFQKNLHMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H31P3/c1-11(2,14)7-10(8-12(3,4)15)9-13(5,6)16/h10H,7-9,14-16H2,1-6H3.
What are the key properties of [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane?
[2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane has a molecular weight of 280.31 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane is sourced from PubChem (CID 123933060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).