C13H31P3 — CID 123933060
[2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane (PubChem CID 123933060) has the molecular formula C13H31P3 and a molecular weight of 280.31 g/mol. Its IUPAC name is [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane.
| Compound Name | [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane |
|---|---|
| PubChem CID | 123933060 |
| Molecular Formula | C13H31P3 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | [2,6-dimethyl-4-(2-methyl-2-phosphanylpropyl)-6-phosphanylheptan-2-yl]phosphane |
| SMILES | CC(C)(P)CC(CC(C)(C)P)CC(C)(C)P |
| InChI | InChI=1S/C13H31P3/c1-11(2,14)7-10(8-12(3,4)15)9-13(5,6)16/h10H,7-9,14-16H2,1-6H3 |
| InChIKey | NTGZFTFQKNLHMB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|