C16H38 — CID 142211592
ethane;2,2,4,6,6-pentamethylheptane (PubChem CID 142211592) has the molecular formula C16H38 and a molecular weight of 230.48 g/mol. Its IUPAC name is ethane;2,2,4,6,6-pentamethylheptane.
| Compound Name | ethane;2,2,4,6,6-pentamethylheptane |
|---|---|
| PubChem CID | 142211592 |
| Molecular Formula | C16H38 |
| Molecular Weight | 230.48 g/mol |
| Exact Mass | 230.30 |
| IUPAC Name | ethane;2,2,4,6,6-pentamethylheptane |
| SMILES | CC.CC.CC(CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C12H26.2C2H6/c1-10(8-11(2,3)4)9-12(5,6)7;2*1-2/h10H,8-9H2,1-7H3;2*1-2H3 |
| InChIKey | WEQBLLWJGMJLLJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |