C17H36 — CID 54023173
2,2,4,8,10,10-hexamethylundecane (PubChem CID 54023173) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is 2,2,4,8,10,10-hexamethylundecane.
| Compound Name | 2,2,4,8,10,10-hexamethylundecane |
|---|---|
| PubChem CID | 54023173 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 2,2,4,8,10,10-hexamethylundecane |
| SMILES | CC(CCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C17H36/c1-14(12-16(3,4)5)10-9-11-15(2)13-17(6,7)8/h14-15H,9-13H2,1-8H3 |
| InChIKey | KFZVDXQVSQAJHC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |